Products 2890674-43-6

CAS 2890674-43-6 is the registry number for S-(2-Bromo-6-methoxyphenyl) ethanethioate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

S-(2-bromo-6-methoxyphenyl) ethanethioate (CAS 2890674-43-6) is a chemical compound with the molecular formula C9H9BrO2S and a molecular weight of 261.14 g/mol. IUPAC name: S-(2-bromo-6-methoxyphenyl) ethanethioate. InChIKey: LEUFNJXVHDOCKR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9BrO2S
Molecular weight261.14 g/mol
IUPAC nameS-(2-bromo-6-methoxyphenyl) ethanethioate
InChIKeyLEUFNJXVHDOCKR-UHFFFAOYSA-N
SMILESCC(=O)SC1=C(C=CC=C1Br)OC

Computed by PubChem (NCBI)