CAS 1019111-64-8 appears in our catalog under these names: 2,5–Dibromo–benzothiazole, 2,5-Dibromobenzothiazole 95%, 2,5-Dibromobenzothiazole, 95%, 95%, 2,5-Dibromo-benzothiazole, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g, 500mg.
2,5-dibromo-1,3-benzothiazole (CAS 1019111-64-8) is a chemical compound with the molecular formula C7H3Br2NS and a molecular weight of 292.98 g/mol. IUPAC name: 2,5-dibromo-1,3-benzothiazole. InChIKey: XJVJGOIARLIDRN-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NS |
|---|---|
| Molecular weight | 292.98 g/mol |
| IUPAC name | 2,5-dibromo-1,3-benzothiazole |
| InChIKey | XJVJGOIARLIDRN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(S2)Br |
Computed by PubChem (NCBI)