CAS 1188090-10-9 is the registry number for 2,7-Dibromobenzo(d)thiazole, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,7-dibromo-1,3-benzothiazole (CAS 1188090-10-9) is a chemical compound with the molecular formula C7H3Br2NS and a molecular weight of 292.98 g/mol. IUPAC name: 2,7-dibromo-1,3-benzothiazole. InChIKey: LGPZMZJYFSUFCI-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NS |
|---|---|
| Molecular weight | 292.98 g/mol |
| IUPAC name | 2,7-dibromo-1,3-benzothiazole |
| InChIKey | LGPZMZJYFSUFCI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)SC(=N2)Br |
Computed by PubChem (NCBI)