CAS 408328-13-2 appears in our catalog under these names: 2,6–Dibromobenzothiazole, 2,6-Dibromobenzothiazole 95%, 2,6-Dibromobenzothiazole, 95%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100g, 250mg, 10g, 25g.
2,6-dibromo-1,3-benzothiazole (CAS 408328-13-2) is a chemical compound with the molecular formula C7H3Br2NS and a molecular weight of 292.98 g/mol. IUPAC name: 2,6-dibromo-1,3-benzothiazole. InChIKey: LQVHXPZEBKDACR-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NS |
|---|---|
| Molecular weight | 292.98 g/mol |
| IUPAC name | 2,6-dibromo-1,3-benzothiazole |
| InChIKey | LQVHXPZEBKDACR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)Br |
Computed by PubChem (NCBI)