CAS 700-48-1 is the registry number for 4,6-Dibromobenzothiazole. Offered by: TRC. Available pack sizes: 500mg.
4,6-dibromo-1,3-benzothiazole (CAS 700-48-1) is a chemical compound with the molecular formula C7H3Br2NS and a molecular weight of 292.98 g/mol. IUPAC name: 4,6-dibromo-1,3-benzothiazole. InChIKey: IIQFYLMDHBRKCK-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2NS |
|---|---|
| Molecular weight | 292.98 g/mol |
| IUPAC name | 4,6-dibromo-1,3-benzothiazole |
| InChIKey | IIQFYLMDHBRKCK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC=N2)Br)Br |
Computed by PubChem (NCBI)