Products 1019115-70-8
CAS 1019115-70-8 appears in our catalog under these names: 2-Bromo-5-ethoxybenzene-1-sulfonyl chloride, 95%, 2-Bromo-5-ethoxybenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-bromo-5-ethoxybenzenesulfonyl chloride (CAS 1019115-70-8) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: 2-bromo-5-ethoxybenzenesulfonyl chloride. InChIKey: ZNWZYJKWDWVOOU-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO3S |
|---|---|
| Molecular weight | 299.57 g/mol |
| IUPAC name | 2-bromo-5-ethoxybenzenesulfonyl chloride |
| InChIKey | ZNWZYJKWDWVOOU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC(=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)