Products 1397202-80-0

CAS 1397202-80-0 appears in our catalog under these names: (2-Bromo-5-methoxyphenyl)methanesulfonyl chloride, 95%, (2-Bromo-5-methoxyphenyl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

(2-bromo-5-methoxyphenyl)methanesulfonyl chloride (CAS 1397202-80-0) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: (2-bromo-5-methoxyphenyl)methanesulfonyl chloride. InChIKey: UGDONJBCTOYANW-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClO3S
Molecular weight299.57 g/mol
IUPAC name(2-bromo-5-methoxyphenyl)methanesulfonyl chloride
InChIKeyUGDONJBCTOYANW-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)Br)CS(=O)(=O)Cl

Computed by PubChem (NCBI)