Products 379255-01-3

CAS 379255-01-3 appears in our catalog under these names: 5-Bromo-2-ethoxy-benzenesulfonyl chloride, 96%, 5-Bromo-2-ethoxy-benzenesulfonyl chloride. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g, 50mg.

Structural formula: {0} (CAS {1})

5-bromo-2-ethoxybenzenesulfonyl chloride (CAS 379255-01-3) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: 5-bromo-2-ethoxybenzenesulfonyl chloride. InChIKey: QVECNSRYIWTUJL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClO3S
Molecular weight299.57 g/mol
IUPAC name5-bromo-2-ethoxybenzenesulfonyl chloride
InChIKeyQVECNSRYIWTUJL-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)