CAS 379255-01-3 appears in our catalog under these names: 5-Bromo-2-ethoxy-benzenesulfonyl chloride, 96%, 5-Bromo-2-ethoxy-benzenesulfonyl chloride. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 10g, 5g, 1g, 25g, 50mg.
5-bromo-2-ethoxybenzenesulfonyl chloride (CAS 379255-01-3) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: 5-bromo-2-ethoxybenzenesulfonyl chloride. InChIKey: QVECNSRYIWTUJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO3S |
|---|---|
| Molecular weight | 299.57 g/mol |
| IUPAC name | 5-bromo-2-ethoxybenzenesulfonyl chloride |
| InChIKey | QVECNSRYIWTUJL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)