Products 1093065-10-1

CAS 1093065-10-1 is the registry number for 3-Bromo-4-ethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

3-bromo-4-ethoxybenzenesulfonyl chloride (CAS 1093065-10-1) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: 3-bromo-4-ethoxybenzenesulfonyl chloride. InChIKey: FKYSPRCRSDOCJL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8BrClO3S
Molecular weight299.57 g/mol
IUPAC name3-bromo-4-ethoxybenzenesulfonyl chloride
InChIKeyFKYSPRCRSDOCJL-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)Br

Computed by PubChem (NCBI)