CAS 1093065-10-1 is the registry number for 3-Bromo-4-ethoxybenzene-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-bromo-4-ethoxybenzenesulfonyl chloride (CAS 1093065-10-1) is a chemical compound with the molecular formula C8H8BrClO3S and a molecular weight of 299.57 g/mol. IUPAC name: 3-bromo-4-ethoxybenzenesulfonyl chloride. InChIKey: FKYSPRCRSDOCJL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrClO3S |
|---|---|
| Molecular weight | 299.57 g/mol |
| IUPAC name | 3-bromo-4-ethoxybenzenesulfonyl chloride |
| InChIKey | FKYSPRCRSDOCJL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)