Products 1019202-25-5
CAS 1019202-25-5 appears in our catalog under these names: tert-Butyl ethynyl(phenyl)carbamate, 95%, 95%, tert-Butyl ethynyl(phenyl)carbamate, 95%, Tert-Butyl Ethynyl(Phenyl)Carbamate, 98%. Offered by: Chemat, Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
Tert-butyl N-ethynyl-N-phenylcarbamate (CAS 1019202-25-5) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: tert-butyl N-ethynyl-N-phenylcarbamate. InChIKey: XVAGMZSYMOTBMA-UHFFFAOYSA-N.
| Molecular formula | C13H15NO2 |
|---|---|
| Molecular weight | 217.26 g/mol |
| IUPAC name | tert-butyl N-ethynyl-N-phenylcarbamate |
| InChIKey | XVAGMZSYMOTBMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C#C)C1=CC=CC=C1 |
Computed by PubChem (NCBI)