Products 1019355-72-6

CAS 1019355-72-6 is the registry number for Ethyl 4-chloro-6-fluoro-8-methylquinoline-3-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-6-fluoro-8-methylquinoline-3-carboxylate (CAS 1019355-72-6) is a chemical compound with the molecular formula C13H11ClFNO2 and a molecular weight of 267.68 g/mol. IUPAC name: ethyl 4-chloro-6-fluoro-8-methylquinoline-3-carboxylate. InChIKey: BWLFRHZFOXGIPH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClFNO2
Molecular weight267.68 g/mol
IUPAC nameethyl 4-chloro-6-fluoro-8-methylquinoline-3-carboxylate
InChIKeyBWLFRHZFOXGIPH-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C2C(=CC(=CC2=C1Cl)F)C

Computed by PubChem (NCBI)