Products 2108982-08-5
CAS 2108982-08-5 is the registry number for Methyl 3-(5-fluoropyridin-2-yl)benzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
Methyl 3-(5-fluoro-2-pyridinyl)benzoate;hydrochloride (CAS 2108982-08-5) is a chemical compound with the molecular formula C13H11ClFNO2 and a molecular weight of 267.68 g/mol. IUPAC name: methyl 3-(5-fluoro-2-pyridinyl)benzoate;hydrochloride. InChIKey: OYVKXZCKANDJGT-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO2 |
|---|---|
| Molecular weight | 267.68 g/mol |
| IUPAC name | methyl 3-(5-fluoro-2-pyridinyl)benzoate;hydrochloride |
| InChIKey | OYVKXZCKANDJGT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=NC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)