CAS 1284559-81-4 is the registry number for 3-Quinolinecarboxylic acid, 4-chloro-7-fluoro-8-methyl-, ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-chloro-7-fluoro-8-methylquinoline-3-carboxylate (CAS 1284559-81-4) is a chemical compound with the molecular formula C13H11ClFNO2 and a molecular weight of 267.68 g/mol. IUPAC name: ethyl 4-chloro-7-fluoro-8-methylquinoline-3-carboxylate. InChIKey: WSCNNFGWXUPWJY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO2 |
|---|---|
| Molecular weight | 267.68 g/mol |
| IUPAC name | ethyl 4-chloro-7-fluoro-8-methylquinoline-3-carboxylate |
| InChIKey | WSCNNFGWXUPWJY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2C(=C(C=CC2=C1Cl)F)C |
Computed by PubChem (NCBI)