CAS 881674-01-7 appears in our catalog under these names: Ethyl 2-chloro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate, 97%, Ethyl 2-Chloro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
Ethyl 2-chloro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate (CAS 881674-01-7) is a chemical compound with the molecular formula C13H11ClFNO2 and a molecular weight of 267.68 g/mol. IUPAC name: ethyl 2-chloro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate. InChIKey: XKHNEVMEVCRYQH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClFNO2 |
|---|---|
| Molecular weight | 267.68 g/mol |
| IUPAC name | ethyl 2-chloro-5-(2-fluorophenyl)-1H-pyrrole-3-carboxylate |
| InChIKey | XKHNEVMEVCRYQH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C1)C2=CC=CC=C2F)Cl |
Computed by PubChem (NCBI)