CAS 1019384-47-4 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-4-fluorobenzoic acid, 2-[(tert-Butoxycarbonyl)amino]-4-fluorobenzoic acid, 97%, 2-((tert-Butoxycarbonyl)amino)-4-fluorobenzoic acid, 97%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg.
4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1019384-47-4) is a chemical compound with the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. IUPAC name: 4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: WDQLOJRKJMUXDP-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO4 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 4-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | WDQLOJRKJMUXDP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)F)C(=O)O |
Computed by PubChem (NCBI)