CAS 1184472-44-3 appears in our catalog under these names: 3-{((tert-Butoxy)carbonyl)amino}-4-fluorobenzoic acid, 3-{((tert-butoxy)carbonyl)amino}-4-fluorobenzoic acid, 95%, 3-([(tert-Butoxy)carbonyl]amino)-4-fluorobenzoic acid, 98%, 98%, 3-{[(tert-butoxy)carbonyl]amino}-4-fluorobenzoic acid, 98%. Offered by: Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 5g, 50mg, 100mg.
4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1184472-44-3) is a chemical compound with the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. IUPAC name: 4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: PEZSGCBQTNYZCL-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO4 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 4-fluoro-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | PEZSGCBQTNYZCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)