Products 141940-30-9

CAS 141940-30-9 is the registry number for 2-((tert-Butoxycarbonyl)amino)-3-fluorobenzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 141940-30-9) is a chemical compound with the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. IUPAC name: 3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: GLQNIDBIWCJFBX-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14FNO4
Molecular weight255.24 g/mol
IUPAC name3-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
InChIKeyGLQNIDBIWCJFBX-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=C(C=CC=C1F)C(=O)O

Computed by PubChem (NCBI)