CAS 1326229-56-4 appears in our catalog under these names: 4-((tert-Butoxycarbonyl)amino)-2-fluorobenzoic acid, 98%, 4-((tert-Butoxycarbonyl)amino)-2-fluorobenzoic acid, 98%, 98%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1326229-56-4) is a chemical compound with the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. IUPAC name: 2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: UTVJFITUVRCJJA-UHFFFAOYSA-N.
| Molecular formula | C12H14FNO4 |
|---|---|
| Molecular weight | 255.24 g/mol |
| IUPAC name | 2-fluoro-4-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | UTVJFITUVRCJJA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC(=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)