Products 1019384-91-8
CAS 1019384-91-8 appears in our catalog under these names: 3-Bromo-4-(dimethylsulfamoyl)benzoic acid, 95%, 3-Bromo-4-(dimethylsulfamoyl)benzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2g, 5g, 10g.
3-bromo-4-(dimethylsulfamoyl)benzoic acid (CAS 1019384-91-8) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: 3-bromo-4-(dimethylsulfamoyl)benzoic acid. InChIKey: PVZZRMYVFSLWKH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | 3-bromo-4-(dimethylsulfamoyl)benzoic acid |
| InChIKey | PVZZRMYVFSLWKH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=C(C=C(C=C1)C(=O)O)Br |
Computed by PubChem (NCBI)