CAS 14347-24-1 appears in our catalog under these names: N-[5-(2-Bromo-acetyl)-2-hydroxy-phenyl]-methanesulfonamide, 95%, N-(5-(2-Bromoacetyl)-2-hydroxyphenyl)methanesulfonamide, 95%, N-[5-(2-Bromo-acetyl)-2-hydroxy-phenyl]-methanesulfonamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
N-[5-(2-bromoacetyl)-2-hydroxyphenyl]methanesulfonamide (CAS 14347-24-1) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: N-[5-(2-bromoacetyl)-2-hydroxyphenyl]methanesulfonamide. InChIKey: GYEQBFBEBZJFLU-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | N-[5-(2-bromoacetyl)-2-hydroxyphenyl]methanesulfonamide |
| InChIKey | GYEQBFBEBZJFLU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=C(C=CC(=C1)C(=O)CBr)O |
Computed by PubChem (NCBI)