Products 900174-33-6
CAS 900174-33-6 is the registry number for Benzene, 2-bromo-1-[(1-methylethyl)sulfonyl]-4-nitro-, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-4-nitro-1-propan-2-ylsulfonylbenzene (CAS 900174-33-6) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: 2-bromo-4-nitro-1-propan-2-ylsulfonylbenzene. InChIKey: ZBOKJWIBASBIED-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | 2-bromo-4-nitro-1-propan-2-ylsulfonylbenzene |
| InChIKey | ZBOKJWIBASBIED-UHFFFAOYSA-N |
| SMILES | CC(C)S(=O)(=O)C1=C(C=C(C=C1)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)