CAS 349405-06-7 appears in our catalog under these names: Methyl 2-[(4-bromobenzene)sulfonamido]acetate, 95%, Methyl 2-(4-bromobenzenesulfonamido)acetate. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 0,5g.
Methyl 2-[(4-bromophenyl)sulfonylamino]acetate (CAS 349405-06-7) is a chemical compound with the molecular formula C9H10BrNO4S and a molecular weight of 308.15 g/mol. IUPAC name: methyl 2-[(4-bromophenyl)sulfonylamino]acetate. InChIKey: RKMMKFPYCKUIAN-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNO4S |
|---|---|
| Molecular weight | 308.15 g/mol |
| IUPAC name | methyl 2-[(4-bromophenyl)sulfonylamino]acetate |
| InChIKey | RKMMKFPYCKUIAN-UHFFFAOYSA-N |
| SMILES | COC(=O)CNS(=O)(=O)C1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)