CAS 1019438-49-3 appears in our catalog under these names: 3-(1,2,3,4-Tetrahydroisoquinoline-2-carbonyl)phenol, 3-(1,2,3,4-Tetrahydroisoquinoline-2-carbonyl)phenol, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 100mg, 1g, 5g.
3,4-dihydro-1H-isoquinolin-2-yl-(3-hydroxyphenyl)methanone (CAS 1019438-49-3) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 3,4-dihydro-1H-isoquinolin-2-yl-(3-hydroxyphenyl)methanone. InChIKey: BFXJXSCXRCMOGV-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 3,4-dihydro-1H-isoquinolin-2-yl-(3-hydroxyphenyl)methanone |
| InChIKey | BFXJXSCXRCMOGV-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=O)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)