Products 1019443-74-3
CAS 1019443-74-3 is the registry number for (2-Chlorophenyl)(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine (CAS 1019443-74-3) is a chemical compound with the molecular formula C15H14ClNO2 and a molecular weight of 275.73 g/mol. IUPAC name: (2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine. InChIKey: ACOUQABLVLKBMO-UHFFFAOYSA-N.
| Molecular formula | C15H14ClNO2 |
|---|---|
| Molecular weight | 275.73 g/mol |
| IUPAC name | (2-chlorophenyl)-(2,3-dihydro-1,4-benzodioxin-6-yl)methanamine |
| InChIKey | ACOUQABLVLKBMO-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(C3=CC=CC=C3Cl)N |
Computed by PubChem (NCBI)