Products 1019462-57-7
CAS 1019462-57-7 appears in our catalog under these names: 3-((3-Fluorophenoxy)methyl)benzoic acid, 95+%, 3-(3-Fluorophenoxymethyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
3-[(3-fluorophenoxy)methyl]benzoic acid (CAS 1019462-57-7) is a chemical compound with the molecular formula C14H11FO3 and a molecular weight of 246.23 g/mol. IUPAC name: 3-[(3-fluorophenoxy)methyl]benzoic acid. InChIKey: RTGKHBCSSWTVIL-UHFFFAOYSA-N.
| Molecular formula | C14H11FO3 |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | 3-[(3-fluorophenoxy)methyl]benzoic acid |
| InChIKey | RTGKHBCSSWTVIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)COC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)