Products 1019465-60-1

CAS 1019465-60-1 is the registry number for 4-(3-Cyclohexylpropanamido)-2-hydroxybenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(3-cyclohexylpropanoylamino)-2-hydroxybenzoic acid (CAS 1019465-60-1) is a chemical compound with the molecular formula C16H21NO4 and a molecular weight of 291.34 g/mol. IUPAC name: 4-(3-cyclohexylpropanoylamino)-2-hydroxybenzoic acid. InChIKey: WZQKDZDMVRJDET-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO4
Molecular weight291.34 g/mol
IUPAC name4-(3-cyclohexylpropanoylamino)-2-hydroxybenzoic acid
InChIKeyWZQKDZDMVRJDET-UHFFFAOYSA-N
SMILESC1CCC(CC1)CCC(=O)NC2=CC(=C(C=C2)C(=O)O)O

Computed by PubChem (NCBI)