CAS 1019575-55-3 is the registry number for 5-(Quinolin-2-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-quinolin-2-yl-1,3,4-thiadiazol-2-amine (CAS 1019575-55-3) is a chemical compound with the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. IUPAC name: 5-quinolin-2-yl-1,3,4-thiadiazol-2-amine. InChIKey: UTWADPGAMRHGME-UHFFFAOYSA-N.
| Molecular formula | C11H8N4S |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | 5-quinolin-2-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | UTWADPGAMRHGME-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C3=NN=C(S3)N |
Computed by PubChem (NCBI)