CAS 1251923-70-2 is the registry number for 4-(2-(1H-Imidazol-5-yl)-1,3-thiazol-4-yl)pyridine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(1H-imidazol-5-yl)-4-pyridin-4-yl-1,3-thiazole (CAS 1251923-70-2) is a chemical compound with the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. IUPAC name: 2-(1H-imidazol-5-yl)-4-pyridin-4-yl-1,3-thiazole. InChIKey: VTYAGAKAEFRORU-UHFFFAOYSA-N.
| Molecular formula | C11H8N4S |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | 2-(1H-imidazol-5-yl)-4-pyridin-4-yl-1,3-thiazole |
| InChIKey | VTYAGAKAEFRORU-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=CSC(=N2)C3=CN=CN3 |
Computed by PubChem (NCBI)