CAS 7190-83-2 is the registry number for 3-Phenyl[1,2,4]triazolo[4,3-b]pyridazine-6-thiol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-phenyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione (CAS 7190-83-2) is a chemical compound with the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. IUPAC name: 3-phenyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione. InChIKey: ZFSRIRQNMXGKGG-UHFFFAOYSA-N.
| Molecular formula | C11H8N4S |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | 3-phenyl-5H-[1,2,4]triazolo[4,3-b]pyridazine-6-thione |
| InChIKey | ZFSRIRQNMXGKGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C3N2NC(=S)C=C3 |
Computed by PubChem (NCBI)