CAS 1340216-86-5 is the registry number for 5-(Quinolin-5-yl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-quinolin-5-yl-1,3,4-thiadiazol-2-amine (CAS 1340216-86-5) is a chemical compound with the molecular formula C11H8N4S and a molecular weight of 228.28 g/mol. IUPAC name: 5-quinolin-5-yl-1,3,4-thiadiazol-2-amine. InChIKey: KKZPSTWRCVXRCH-UHFFFAOYSA-N.
| Molecular formula | C11H8N4S |
|---|---|
| Molecular weight | 228.28 g/mol |
| IUPAC name | 5-quinolin-5-yl-1,3,4-thiadiazol-2-amine |
| InChIKey | KKZPSTWRCVXRCH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=CC=NC2=C1)C3=NN=C(S3)N |
Computed by PubChem (NCBI)