Products 101976-73-2
CAS 101976-73-2 appears in our catalog under these names: (R)-2-(Adamantan-1-yl)-2-aminoacetic acid hydrochloride 97%, (R)-2-(Adamantan-1-yl)-2-aminoacetic acid hydrochloride, 97%, (R)-2-(Adamantan-1-yl)-2-aminoacetic acid hydrochloride, 97% ,, 97% ,, (R)-2-((3R,5R,7R)-Adamantan-1-yl)-2-aminoacetic acid hydrochloride, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2R)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride (CAS 101976-73-2) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: (2R)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride. InChIKey: HEUUMSMIQNBXML-FLZHOMMYSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | (2R)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride |
| InChIKey | HEUUMSMIQNBXML-FLZHOMMYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)[C@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)