CAS 102502-64-7 appears in our catalog under these names: (S)-Adamantylglycine Hydrochloride, (S)–2–(adamantan–1–yl)–2–aminoacetic acid hydrochloride, (S)-H-2-(Adamantan-1-yl)-Gly-OH HCl 95%, (S)-2-(Adamantan-1-yl)-2-aminoacetic acid hydrochloride, 95%, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 50mg, 250mg, 5g, 10g.
(2S)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride (CAS 102502-64-7) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: (2S)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride. InChIKey: HEUUMSMIQNBXML-FQPTWHMSSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | (2S)-2-(1-adamantyl)-2-aminoacetic acid;hydrochloride |
| InChIKey | HEUUMSMIQNBXML-FQPTWHMSSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)