Products 16091-96-6

CAS 16091-96-6 is the registry number for 1-Adamantyl(amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.

Structural formula: {0} (CAS {1})

2-(1-adamantyl)-2-aminoacetic acid;hydrochloride (CAS 16091-96-6) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: 2-(1-adamantyl)-2-aminoacetic acid;hydrochloride. InChIKey: HEUUMSMIQNBXML-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20ClNO2
Molecular weight245.74 g/mol
IUPAC name2-(1-adamantyl)-2-aminoacetic acid;hydrochloride
InChIKeyHEUUMSMIQNBXML-UHFFFAOYSA-N
SMILESC1C2CC3CC1CC(C2)(C3)C(C(=O)O)N.Cl

Computed by PubChem (NCBI)