CAS 16091-96-6 is the registry number for 1-Adamantyl(amino)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg, 1000mg.
2-(1-adamantyl)-2-aminoacetic acid;hydrochloride (CAS 16091-96-6) is a chemical compound with the molecular formula C12H20ClNO2 and a molecular weight of 245.74 g/mol. IUPAC name: 2-(1-adamantyl)-2-aminoacetic acid;hydrochloride. InChIKey: HEUUMSMIQNBXML-UHFFFAOYSA-N.
| Molecular formula | C12H20ClNO2 |
|---|---|
| Molecular weight | 245.74 g/mol |
| IUPAC name | 2-(1-adamantyl)-2-aminoacetic acid;hydrochloride |
| InChIKey | HEUUMSMIQNBXML-UHFFFAOYSA-N |
| SMILES | C1C2CC3CC1CC(C2)(C3)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)