Products 1019776-84-1
CAS 1019776-84-1 is the registry number for (2,2-Dimethyl-1,3-dioxaindan-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine (CAS 1019776-84-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine. InChIKey: AZFZYNWXGOTZFG-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine |
| InChIKey | AZFZYNWXGOTZFG-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)CN)C |
Computed by PubChem (NCBI)