CAS 10199-91-4 appears in our catalog under these names: 7-Nitro-4-aminobenzofurazan, 7-Amino-4-nitro-2,1,3-benzoxadiazole, NBD-amine 98%, 7-Nitrobenzo[c][1,2,5]oxadiazol-4-amine, 98%, 98%, NBD-amine, 96.70%. Offered by: TRC, Chemat, Ambeed, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 250mg, 1g, 10 mg, 5 mg, 50 mg.
4-nitro-2,1,3-benzoxadiazol-7-amine (CAS 10199-91-4) is a chemical compound with the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. IUPAC name: 4-nitro-2,1,3-benzoxadiazol-7-amine. InChIKey: YXKOGLINWAPXPE-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O3 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 4-nitro-2,1,3-benzoxadiazol-7-amine |
| InChIKey | YXKOGLINWAPXPE-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])N |
Computed by PubChem (NCBI)