CAS 112298-47-2 is the registry number for 1,4–Dihydro–4–Oxo–Pyrazolo(5,1–C)(1,2,4)Triazine–3–Carboxylic Acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
4-oxo-6H-pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid (CAS 112298-47-2) is a chemical compound with the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. IUPAC name: 4-oxo-6H-pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid. InChIKey: HWNRPIPNGDLAGY-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O3 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 4-oxo-6H-pyrazolo[5,1-c][1,2,4]triazine-3-carboxylic acid |
| InChIKey | HWNRPIPNGDLAGY-UHFFFAOYSA-N |
| SMILES | C1=CNN2C1=NN=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)