CAS 98141-78-7 is the registry number for 6,7–dihydro–6–oxo–1H–purine–8–carboxylicacid. Offered by: GLPBio. Available pack sizes: 1g.
6-oxo-1,7-dihydropurine-8-carboxylic acid (CAS 98141-78-7) is a chemical compound with the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. IUPAC name: 6-oxo-1,7-dihydropurine-8-carboxylic acid. InChIKey: VLTQYUMUUKLHOU-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O3 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 6-oxo-1,7-dihydropurine-8-carboxylic acid |
| InChIKey | VLTQYUMUUKLHOU-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(C(=O)N1)NC(=N2)C(=O)O |
Computed by PubChem (NCBI)