CAS 2140305-65-1 is the registry number for 2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid (CAS 2140305-65-1) is a chemical compound with the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. IUPAC name: 2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid. InChIKey: PBKBUDIASJAHGJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O3 |
|---|---|
| Molecular weight | 180.12 g/mol |
| IUPAC name | 2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid |
| InChIKey | PBKBUDIASJAHGJ-UHFFFAOYSA-N |
| SMILES | C1=NN2C=NC(=O)NC2=C1C(=O)O |
Computed by PubChem (NCBI)