Products 2140305-65-1

CAS 2140305-65-1 is the registry number for 2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid (CAS 2140305-65-1) is a chemical compound with the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. IUPAC name: 2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid. InChIKey: PBKBUDIASJAHGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4N4O3
Molecular weight180.12 g/mol
IUPAC name2-oxo-1H-pyrazolo[1,5-a][1,3,5]triazine-8-carboxylic acid
InChIKeyPBKBUDIASJAHGJ-UHFFFAOYSA-N
SMILESC1=NN2C=NC(=O)NC2=C1C(=O)O

Computed by PubChem (NCBI)