Products 1019995-79-9

CAS 1019995-79-9 is the registry number for 3-Benzyl-1-(4-methoxybenzyl)-1,3-dihydroindol-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.

Structural formula: {0} (CAS {1})

3-benzyl-1-[(4-methoxyphenyl)methyl]-3H-indol-2-one (CAS 1019995-79-9) is a chemical compound with the molecular formula C23H21NO2 and a molecular weight of 343.4 g/mol. IUPAC name: 3-benzyl-1-[(4-methoxyphenyl)methyl]-3H-indol-2-one. InChIKey: FOWJMHSYDZYOID-UHFFFAOYSA-N.

Identity
Molecular formulaC23H21NO2
Molecular weight343.4 g/mol
IUPAC name3-benzyl-1-[(4-methoxyphenyl)methyl]-3H-indol-2-one
InChIKeyFOWJMHSYDZYOID-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CN2C3=CC=CC=C3C(C2=O)CC4=CC=CC=C4

Computed by PubChem (NCBI)