CAS 2749316-88-7 is the registry number for JWH 073 7–hydroxyindole metabolite–d7. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
[1-(2,2,3,3,4,4,4-heptadeuteriobutyl)-7-hydroxyindol-3-yl]-naphthalen-1-ylmethanone (CAS 2749316-88-7) is a chemical compound with the molecular formula C23H21NO2 and a molecular weight of 350.5 g/mol. IUPAC name: [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)-7-hydroxyindol-3-yl]-naphthalen-1-ylmethanone. InChIKey: RERSSQCTZKUWMM-NCKGIQLSSA-N.
| Molecular formula | C23H21NO2 |
|---|---|
| Molecular weight | 350.5 g/mol |
| IUPAC name | [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)-7-hydroxyindol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | RERSSQCTZKUWMM-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CN1C=C(C2=C1C(=CC=C2)O)C(=O)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)