CAS 2484976-96-5 appears in our catalog under these names: JWH-073 (Indole-d5) 4-Hydroxybutyl, JWH 073 N–(4–hydroxybutyl) metabolite–d5. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 1mg, 100μg, 500μg.
Naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(4-hydroxybutyl)indol-3-yl]methanone (CAS 2484976-96-5) is a chemical compound with the molecular formula C23H21NO2 and a molecular weight of 348.4 g/mol. IUPAC name: naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(4-hydroxybutyl)indol-3-yl]methanone. InChIKey: FIBVDFAPDNJBNI-HXXXRZHPSA-N.
| Molecular formula | C23H21NO2 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | naphthalen-1-yl-[2,4,5,6,7-pentadeuterio-1-(4-hydroxybutyl)indol-3-yl]methanone |
| InChIKey | FIBVDFAPDNJBNI-HXXXRZHPSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCO)[2H])C(=O)C3=CC=CC4=CC=CC=C43)[2H])[2H] |
Computed by PubChem (NCBI)