CAS 2748589-83-3 is the registry number for (S)–(+)–JWH 073 N–(3–hydroxybutyl) metabolite. Offered by: GLPBio. Available pack sizes: 1mg, 10mg, 5mg.
[1-[(3S)-3-hydroxybutyl]indol-3-yl]-naphthalen-1-ylmethanone (CAS 2748589-83-3) is a chemical compound with the molecular formula C23H21NO2 and a molecular weight of 343.4 g/mol. IUPAC name: [1-[(3S)-3-hydroxybutyl]indol-3-yl]-naphthalen-1-ylmethanone. InChIKey: YPRJGJFJMZOUSH-INIZCTEOSA-N.
| Molecular formula | C23H21NO2 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | [1-[(3S)-3-hydroxybutyl]indol-3-yl]-naphthalen-1-ylmethanone |
| InChIKey | YPRJGJFJMZOUSH-INIZCTEOSA-N |
| SMILES | C[C@@H](CCN1C=C(C2=CC=CC=C21)C(=O)C3=CC=CC4=CC=CC=C43)O |
Computed by PubChem (NCBI)