CAS 1020050-89-8 is the registry number for (2E)-3-(3-[(3,5-Dimethyl-1h-pyrazol-1-yl)methyl]-4-methoxyphenyl)acrylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-enoic acid (CAS 1020050-89-8) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: (E)-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-enoic acid. InChIKey: CKKUVVHLVILXIU-FNORWQNLSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | (E)-3-[3-[(3,5-dimethylpyrazol-1-yl)methyl]-4-methoxyphenyl]prop-2-enoic acid |
| InChIKey | CKKUVVHLVILXIU-FNORWQNLSA-N |
| SMILES | CC1=CC(=NN1CC2=C(C=CC(=C2)/C=C/C(=O)O)OC)C |
Computed by PubChem (NCBI)