CAS 4792-83-0 appears in our catalog under these names: 4,4'-Azoxydiphenetole, 98%, 4,4'-Azoxydiphenetole, >95% (HPLC), p-Azoxyphenetole, 98%. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 2,5g, 500mg.
(4-ethoxyphenyl)-(4-ethoxyphenyl)imino-oxidoazanium (CAS 4792-83-0) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: (4-ethoxyphenyl)-(4-ethoxyphenyl)imino-oxidoazanium. InChIKey: QUICZVHSJNKDBL-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | (4-ethoxyphenyl)-(4-ethoxyphenyl)imino-oxidoazanium |
| InChIKey | QUICZVHSJNKDBL-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N=[N+](C2=CC=C(C=C2)OCC)[O-] |
Computed by PubChem (NCBI)