CAS 123865-06-5 is the registry number for N-[Amino(4,4-dimethyl-2,6-dioxocyclohexylidene)methyl]benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N-[amino-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylidene]benzamide (CAS 123865-06-5) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: N-[amino-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylidene]benzamide. InChIKey: OOUWONJHYOAQNL-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | N-[amino-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)methylidene]benzamide |
| InChIKey | OOUWONJHYOAQNL-UHFFFAOYSA-N |
| SMILES | CC1(CC(=C(C(=O)C1)C(=NC(=O)C2=CC=CC=C2)N)O)C |
Computed by PubChem (NCBI)