CAS 1415719-09-3 is the registry number for 1-(4-Acetylphenyl)-3-[(cyclopropylmethyl)amino]pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-(4-acetylphenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione (CAS 1415719-09-3) is a chemical compound with the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. IUPAC name: 1-(4-acetylphenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione. InChIKey: KIWCQZOUIROYBM-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O3 |
|---|---|
| Molecular weight | 286.33 g/mol |
| IUPAC name | 1-(4-acetylphenyl)-3-(cyclopropylmethylamino)pyrrolidine-2,5-dione |
| InChIKey | KIWCQZOUIROYBM-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)N2C(=O)CC(C2=O)NCC3CC3 |
Computed by PubChem (NCBI)