CAS 1020243-34-8 is the registry number for Ethyl 5-nitroindoline-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 5-nitro-2,3-dihydroindole-1-carboxylate (CAS 1020243-34-8) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: ethyl 5-nitro-2,3-dihydroindole-1-carboxylate. InChIKey: SYKQIUQNZZTHTO-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | ethyl 5-nitro-2,3-dihydroindole-1-carboxylate |
| InChIKey | SYKQIUQNZZTHTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)N1CCC2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)