Products 1020251-91-5
CAS 1020251-91-5 is the registry number for 2-(4-(((1,3-dioxoindan-2-ylidene)methyl)amino)phenyl)ethanenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[4-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]phenyl]acetonitrile (CAS 1020251-91-5) is a chemical compound with the molecular formula C18H12N2O2 and a molecular weight of 288.3 g/mol. IUPAC name: 2-[4-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]phenyl]acetonitrile. InChIKey: DCBHBUAZOUVKIV-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2 |
|---|---|
| Molecular weight | 288.3 g/mol |
| IUPAC name | 2-[4-[(1-hydroxy-3-oxoinden-2-yl)methylideneamino]phenyl]acetonitrile |
| InChIKey | DCBHBUAZOUVKIV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C2=O)C=NC3=CC=C(C=C3)CC#N)O |
Computed by PubChem (NCBI)