Products 1020251-95-9
CAS 1020251-95-9 is the registry number for N-(((1,3-dioxoindan-2-ylidene)ethyl)amino)benzamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzamide (CAS 1020251-95-9) is a chemical compound with the molecular formula C18H14N2O3 and a molecular weight of 306.3 g/mol. IUPAC name: N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzamide. InChIKey: YQQPXOFJWITHAG-YBFXNURJSA-N.
| Molecular formula | C18H14N2O3 |
|---|---|
| Molecular weight | 306.3 g/mol |
| IUPAC name | N-[(E)-1-(1-hydroxy-3-oxoinden-2-yl)ethylideneamino]benzamide |
| InChIKey | YQQPXOFJWITHAG-YBFXNURJSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=CC=C1)/C2=C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)