CAS 1020252-15-6 is the registry number for 3-((4-Acetylphenyl)amino)-5-methylcyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
3-(4-acetylanilino)-5-methylcyclohex-2-en-1-one (CAS 1020252-15-6) is a chemical compound with the molecular formula C15H17NO2 and a molecular weight of 243.30 g/mol. IUPAC name: 3-(4-acetylanilino)-5-methylcyclohex-2-en-1-one. InChIKey: SDYPDIJPGWSTHI-UHFFFAOYSA-N.
| Molecular formula | C15H17NO2 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 3-(4-acetylanilino)-5-methylcyclohex-2-en-1-one |
| InChIKey | SDYPDIJPGWSTHI-UHFFFAOYSA-N |
| SMILES | CC1CC(=CC(=O)C1)NC2=CC=C(C=C2)C(=O)C |
Computed by PubChem (NCBI)